Difference between revisions of "N-5-PHOSPHORIBOSYL-ANTHRANILATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MANNOSE-6P == * common-name: ** α-d-mannopyranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite 1-KETO-2-METHYLVALERATE == * common-name: ** (r)-2,3-dihydroxy-3-methylpentanoate * smiles: ** ccc(o)(c)c(c([o-])=o)o * inchi-key: ** pdg...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-KETO-2-METHYLVALERATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-2,3-dihydroxy-3-methylpentanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc(o)(c)c(c([o-])=o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pdgxjdxvgmhuir-ujursfkzsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 147.15 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DIHYDROXYMETVALDEHYDRAT-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ACETOOHBUTREDUCTOISOM-RXN]] |
| − | + | * [[KARI_LPAREN_23dhmp_RPAREN_]] | |
| − | |||
| − | * [[ | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-2,3-dihydroxy-3-methylpentanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pdgxjdxvgmhuir-ujursfkzsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=147.15}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite 1-KETO-2-METHYLVALERATE
- common-name:
- (r)-2,3-dihydroxy-3-methylpentanoate
- smiles:
- ccc(o)(c)c(c([o-])=o)o
- inchi-key:
- pdgxjdxvgmhuir-ujursfkzsa-m
- molecular-weight:
- 147.15
