Difference between revisions of "N-5-PHOSPHORIBOSYL-ANTHRANILATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIAMINOPIMEPIM-RXN DIAMINOPIMEPIM-RXN] == * direction: ** reversible * ec-number: ** [http://enzyme...")
(Created page with "Category:metabolite == Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE == * common-name: ** n-(5-phosphoribosyl)-anthranilate * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIAMINOPIMEPIM-RXN DIAMINOPIMEPIM-RXN] ==
+
== Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE ==
* direction:
+
* common-name:
** reversible
+
** n-(5-phosphoribosyl)-anthranilate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/5.1.1.7 ec-5.1.1.7]
+
** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc2(c=cc=cc(c(=o)[o-])=2))
== Reaction formula ==
+
* inchi-key:
* 1 [[LL-DIAMINOPIMELATE]][c] '''<=>''' 1 [[MESO-DIAMINOPIMELATE]][c]
+
** pmfmjxprnjuymb-gwofurmssa-k
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
== Pathway(s) ==
+
** 346.21
* [[PWY-5097]], L-lysine biosynthesis VI: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5097 PWY-5097]
+
== Reaction(s) known to consume the compound ==
** '''7''' reactions found over '''7''' reactions in the full pathway
+
* [[PRAISOM-RXN]]
* [[DAPLYSINESYN-PWY]], L-lysine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=DAPLYSINESYN-PWY DAPLYSINESYN-PWY]
+
* [[PRTRANS-RXN]]
** '''7''' reactions found over '''9''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[PWY-2941]], L-lysine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2941 PWY-2941]
+
* [[PRTRANS-RXN]]
** '''6''' reactions found over '''9''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
== Reconstruction information  ==
+
{{#set: common-name=n-(5-phosphoribosyl)-anthranilate}}
* category: [[gap-filling]]; source: [[gapfilling_solution_with_meneco_draft_medium]]; tool: [[meneco]]; comment: added for gapfilling
+
{{#set: inchi-key=inchikey=pmfmjxprnjuymb-gwofurmssa-k}}
== External links  ==
+
{{#set: molecular-weight=346.21}}
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15396 15396]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R02735 R02735]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/Q9PMD8 Q9PMD8]
 
** [http://www.uniprot.org/uniprot/Q9JV69 Q9JV69]
 
** [http://www.uniprot.org/uniprot/P44859 P44859]
 
** [http://www.uniprot.org/uniprot/Q58519 Q58519]
 
** [http://www.uniprot.org/uniprot/P0A6K1 P0A6K1]
 
** [http://www.uniprot.org/uniprot/Q51564 Q51564]
 
** [http://www.uniprot.org/uniprot/P46814 P46814]
 
** [http://www.uniprot.org/uniprot/O05322 O05322]
 
{{#set: direction=reversible}}
 
{{#set: ec-number=ec-5.1.1.7}}
 
{{#set: nb gene associated=0}}
 
{{#set: nb pathway associated=3}}
 
{{#set: reconstruction category=gap-filling}}
 
{{#set: reconstruction tool=meneco}}
 
{{#set: reconstruction comment=added for gapfilling}}
 
{{#set: reconstruction source=gapfilling_solution_with_meneco_draft_medium}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE

  • common-name:
    • n-(5-phosphoribosyl)-anthranilate
  • smiles:
    • c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc2(c=cc=cc(c(=o)[o-])=2))
  • inchi-key:
    • pmfmjxprnjuymb-gwofurmssa-k
  • molecular-weight:
    • 346.21

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality