Difference between revisions of "N-5-PHOSPHORIBOSYL-ANTHRANILATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MANNOSE-6P == * common-name: ** α-d-mannopyranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE == * common-name: ** n-(5-phosphoribosyl)-anthranilate * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-(5-phosphoribosyl)-anthranilate |
* smiles: | * smiles: | ||
| − | ** c(op(=o)([o-])[o-])c1( | + | ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc2(c=cc=cc(c(=o)[o-])=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pmfmjxprnjuymb-gwofurmssa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 346.21 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PRAISOM-RXN]] |
| − | * [[ | + | * [[PRTRANS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PRTRANS-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-(5-phosphoribosyl)-anthranilate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pmfmjxprnjuymb-gwofurmssa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=346.21}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE
- common-name:
- n-(5-phosphoribosyl)-anthranilate
- smiles:
- c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc2(c=cc=cc(c(=o)[o-])=2))
- inchi-key:
- pmfmjxprnjuymb-gwofurmssa-k
- molecular-weight:
- 346.21
