Difference between revisions of "N-5-PHOSPHORIBOSYL-ANTHRANILATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10734 RXN-10734] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:metabolite == Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE == * common-name: ** n-(5-phosphoribosyl)-anthranilate * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10734 RXN-10734] ==
+
== Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE ==
* direction:
+
* common-name:
** left-to-right
+
** n-(5-phosphoribosyl)-anthranilate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.3.1 ec-2.3.1]
+
** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc2(c=cc=cc(c(=o)[o-])=2))
== Reaction formula ==
+
* inchi-key:
* 8 [[MALONYL-COA]][c] '''+''' 7 [[PROTON]][c] '''=>''' 8 [[CARBON-DIOXIDE]][c] '''+''' 8 [[CO-A]][c] '''+''' 1 [[CPD-11555]][c] '''+''' 1 [[WATER]][c]
+
** pmfmjxprnjuymb-gwofurmssa-k
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ18059]]
+
** 346.21
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[PRAISOM-RXN]]
== Pathway(s) ==
+
* [[PRTRANS-RXN]]
* [[PWY-6312]], barbaloin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6312 PWY-6312]
+
== Reaction(s) known to produce the compound ==
** '''1''' reactions found over '''5''' reactions in the full pathway
+
* [[PRTRANS-RXN]]
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=n-(5-phosphoribosyl)-anthranilate}}
== External links  ==
+
{{#set: inchi-key=inchikey=pmfmjxprnjuymb-gwofurmssa-k}}
{{#set: direction=left-to-right}}
+
{{#set: molecular-weight=346.21}}
{{#set: ec-number=ec-2.3.1}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE

  • common-name:
    • n-(5-phosphoribosyl)-anthranilate
  • smiles:
    • c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc2(c=cc=cc(c(=o)[o-])=2))
  • inchi-key:
    • pmfmjxprnjuymb-gwofurmssa-k
  • molecular-weight:
    • 346.21

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality