Difference between revisions of "N-5-PHOSPHORIBOSYL-ANTHRANILATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIAMINOPIMEPIM-RXN DIAMINOPIMEPIM-RXN] == * direction: ** reversible * ec-number: ** [http://enzyme...") |
(Created page with "Category:metabolite == Metabolite CPD-431 == * common-name: ** apigenin * smiles: ** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3))) * inchi-key: ** kznifhplkgyrtm-u...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-431 == |
− | * | + | * common-name: |
− | ** | + | ** apigenin |
− | * | + | * smiles: |
− | ** | + | ** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3))) |
− | == | + | * inchi-key: |
− | + | ** kznifhplkgyrtm-uhfffaoysa-m | |
− | = | + | * molecular-weight: |
− | + | ** 269.233 | |
− | * | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RXN-7651]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=apigenin}} | |
− | ** | + | {{#set: inchi-key=inchikey=kznifhplkgyrtm-uhfffaoysa-m}} |
− | == | + | {{#set: molecular-weight=269.233}} |
− | * | ||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: |
Revision as of 20:36, 18 December 2020
Contents
Metabolite CPD-431
- common-name:
- apigenin
- smiles:
- c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3)))
- inchi-key:
- kznifhplkgyrtm-uhfffaoysa-m
- molecular-weight:
- 269.233