Difference between revisions of "N-5-PHOSPHORIBOSYL-ANTHRANILATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BETA-TOCOPHEROL == * common-name: ** β-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c)) * inchi-key...") |
(Created page with "Category:metabolite == Metabolite DNA-Ligase-L-lysine-guanylate == * common-name: ** a [dna ligase]-l-lysine-guanylate == Reaction(s) known to consume the compound == * ...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DNA-Ligase-L-lysine-guanylate == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [dna ligase]-l-lysine-guanylate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17922]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17921]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [dna ligase]-l-lysine-guanylate}} |
| − | |||
| − | |||
Revision as of 15:29, 5 January 2021
Contents
Metabolite DNA-Ligase-L-lysine-guanylate
- common-name:
- a [dna ligase]-l-lysine-guanylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [dna ligase]-l-lysine-guanylate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
