Difference between revisions of "N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SINAPOYL-COA == * common-name: ** sinapoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(oc...")
(Created page with "Category:metabolite == Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY == * common-name: ** n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine * smiles: ** cc(c)c(nc...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SINAPOYL-COA ==
+
== Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY ==
 
* common-name:
 
* common-name:
** sinapoyl-coa
+
** n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** cc(c)c(nc(=o)c(nc(=o)cccc([n+])c(=o)[o-])cs)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** rbfuwesmwrugfy-gsnioflcsa-j
+
** byeijzfkoaxbbv-qxewzrgksa-m
 
* molecular-weight:
 
* molecular-weight:
** 969.7
+
** 362.42
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1124]]
+
* [[1.21.3.1-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10919]]
 
* [[RXN-1124]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sinapoyl-coa}}
+
{{#set: common-name=n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine}}
{{#set: inchi-key=inchikey=rbfuwesmwrugfy-gsnioflcsa-j}}
+
{{#set: inchi-key=inchikey=byeijzfkoaxbbv-qxewzrgksa-m}}
{{#set: molecular-weight=969.7}}
+
{{#set: molecular-weight=362.42}}

Latest revision as of 11:12, 18 March 2021

Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY

  • common-name:
    • n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine
  • smiles:
    • cc(c)c(nc(=o)c(nc(=o)cccc([n+])c(=o)[o-])cs)c(=o)[o-]
  • inchi-key:
    • byeijzfkoaxbbv-qxewzrgksa-m
  • molecular-weight:
    • 362.42

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.