Difference between revisions of "N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06735 == * transcription-direction: ** positive * right-end-position: ** 71918 * left-end-position: ** 39016 * centisome-position: ** 51.415997...")
 
(Created page with "Category:metabolite == Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY == * common-name: ** n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine * smiles: ** cc(c)c(nc...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ06735 ==
+
== Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine
−
* right-end-position:
+
* smiles:
−
** 71918
+
** cc(c)c(nc(=o)c(nc(=o)cccc([n+])c(=o)[o-])cs)c(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 39016
+
** byeijzfkoaxbbv-qxewzrgksa-m
−
* centisome-position:
+
* molecular-weight:
−
** 51.415997   
+
** 362.42
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[1.21.3.1-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=byeijzfkoaxbbv-qxewzrgksa-m}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=362.42}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=71918}}
 
−
{{#set: left-end-position=39016}}
 
−
{{#set: centisome-position=51.415997    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY

  • common-name:
    • n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine
  • smiles:
    • cc(c)c(nc(=o)c(nc(=o)cccc([n+])c(=o)[o-])cs)c(=o)[o-]
  • inchi-key:
    • byeijzfkoaxbbv-qxewzrgksa-m
  • molecular-weight:
    • 362.42

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.


Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY&oldid=137311"