Difference between revisions of "N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07742 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-8443 ** Category:...") |
(Created page with "Category:metabolite == Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY == * common-name: ** n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine * smiles: ** cc(c)c(nc...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY == |
| − | + | * common-name: | |
| − | * | + | ** n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine |
| − | == | + | * smiles: |
| − | + | ** cc(c)c(nc(=o)c(nc(=o)cccc([n+])c(=o)[o-])cs)c(=o)[o-] | |
| − | * | + | * inchi-key: |
| − | *** | + | ** byeijzfkoaxbbv-qxewzrgksa-m |
| − | == | + | * molecular-weight: |
| − | * [[ | + | ** 362.42 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | {{#set: | + | * [[1.21.3.1-RXN]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| + | {{#set: common-name=n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine}} | ||
| + | {{#set: inchi-key=inchikey=byeijzfkoaxbbv-qxewzrgksa-m}} | ||
| + | {{#set: molecular-weight=362.42}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY
- common-name:
- n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine
- smiles:
- cc(c)c(nc(=o)c(nc(=o)cccc([n+])c(=o)[o-])cs)c(=o)[o-]
- inchi-key:
- byeijzfkoaxbbv-qxewzrgksa-m
- molecular-weight:
- 362.42
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
