Difference between revisions of "N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07742 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-8443 ** Category:...") |
(Created page with "Category:metabolite == Metabolite CPD-8058 == * common-name: ** d-galactosylononitol * smiles: ** coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o)) * inchi-key: ** rsyncmyd...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-8058 == |
| − | == | + | * common-name: |
| − | + | ** d-galactosylononitol | |
| − | == Reaction(s) | + | * smiles: |
| − | * [[RXN- | + | ** coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o)) |
| − | + | * inchi-key: | |
| − | + | ** rsyncmydvzfzbp-nrorzaabsa-n | |
| − | == | + | * molecular-weight: |
| − | + | ** 356.326 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[RXN-8281]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| + | {{#set: common-name=d-galactosylononitol}} | ||
| + | {{#set: inchi-key=inchikey=rsyncmydvzfzbp-nrorzaabsa-n}} | ||
| + | {{#set: molecular-weight=356.326}} | ||
Revision as of 20:31, 18 December 2020
Contents
Metabolite CPD-8058
- common-name:
- d-galactosylononitol
- smiles:
- coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o))
- inchi-key:
- rsyncmydvzfzbp-nrorzaabsa-n
- molecular-weight:
- 356.326
