Difference between revisions of "N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1G-1346 == * common-name: ** trehalose-trans-methoxy-mono-mycolate * smiles: ** ccccccccccccccccccccccccccc(c(occ1(oc(c(c(c1o)o)o)oc2(...") |
(Created page with "Category:metabolite == Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY == * common-name: ** n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine * smiles: ** cc(c)c(nc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)c(nc(=o)c(nc(=o)cccc([n+])c(=o)[o-])cs)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** byeijzfkoaxbbv-qxewzrgksa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 362.42 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[1.21.3.1-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=byeijzfkoaxbbv-qxewzrgksa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=362.42}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY
- common-name:
- n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine
- smiles:
- cc(c)c(nc(=o)c(nc(=o)cccc([n+])c(=o)[o-])cs)c(=o)[o-]
- inchi-key:
- byeijzfkoaxbbv-qxewzrgksa-m
- molecular-weight:
- 362.42
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
