Difference between revisions of "N-ACETYL-5-METHOXY-TRYPTAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12850 == * common-name: ** 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol * inchi-key: ** xzeuytksayn...")
(Created page with "Category:metabolite == Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE == * common-name: ** melatonin * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2)) * inchi-key: ** drlfmbdrbr...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-12850 ==
+
== Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE ==
 
* common-name:
 
* common-name:
−
** 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol
+
** melatonin
 +
* smiles:
 +
** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2))
 
* inchi-key:
 
* inchi-key:
−
** xzeuytksaynypk-wxpwfurysa-n
+
** drlfmbdrbrzale-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 412.698
+
** 232.282
−
* smiles:
 
−
** cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@]4(c)([c@h]1(cc[c@@h]5([c@h](c)[c@@h](o)cc[c@@]2(c[c@@]12cc[c@](c)34)5))))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-11876]]
+
* [[RXN-11056]]
 +
* [[RXN-11057]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-21831]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol}}
+
{{#set: common-name=melatonin}}
−
{{#set: inchi-key=inchikey=xzeuytksaynypk-wxpwfurysa-n}}
+
{{#set: inchi-key=inchikey=drlfmbdrbrzale-uhfffaoysa-n}}
−
{{#set: molecular-weight=412.698}}
+
{{#set: molecular-weight=232.282}}

Latest revision as of 11:13, 18 March 2021

Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE

  • common-name:
    • melatonin
  • smiles:
    • cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2))
  • inchi-key:
    • drlfmbdrbrzale-uhfffaoysa-n
  • molecular-weight:
    • 232.282

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=N-ACETYL-5-METHOXY-TRYPTAMINE&oldid=137687"