Difference between revisions of "N-ACETYL-5-METHOXY-TRYPTAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21137 == * transcription-direction: ** positive * right-end-position: ** 102517 * left-end-position: ** 93688 * centisome-position: ** 47.323383...")
 
(Created page with "Category:metabolite == Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE == * common-name: ** melatonin * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2)) * inchi-key: ** drlfmbdrbr...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21137 ==
+
== Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** melatonin
−
* right-end-position:
+
* smiles:
−
** 102517
+
** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2))
−
* left-end-position:
+
* inchi-key:
−
** 93688
+
** drlfmbdrbrzale-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 47.323383   
+
** 232.282
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-11056]]
−
== Reaction(s) associated ==
+
* [[RXN-11057]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to produce the compound ==
−
* [[1.1.1.145-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=melatonin}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=drlfmbdrbrzale-uhfffaoysa-n}}
−
* [[NADH-DEHYDROGENASE-RXN]]
+
{{#set: molecular-weight=232.282}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12693]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12747]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12789]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-342]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-350]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-353]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6946]]
 
−
** '''6''' reactions found over '''22''' reactions in the full pathway
 
−
* [[PWY-6944]]
 
−
** '''2''' reactions found over '''25''' reactions in the full pathway
 
−
* [[PWY-6948]]
 
−
** '''2''' reactions found over '''18''' reactions in the full pathway
 
−
* [[PWY66-378]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-7299]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=102517}}
 
−
{{#set: left-end-position=93688}}
 
−
{{#set: centisome-position=47.323383    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=8}}
 
−
{{#set: nb pathway associated=5}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE

  • common-name:
    • melatonin
  • smiles:
    • cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2))
  • inchi-key:
    • drlfmbdrbrzale-uhfffaoysa-n
  • molecular-weight:
    • 232.282

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=N-ACETYL-5-METHOXY-TRYPTAMINE&oldid=137687"