Difference between revisions of "N-ACETYL-BETA-D-GLUCOSAMINYL-13-ETCETERA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7526 == * common-name: ** 9,9'-di-cis-ζ-carotene * smiles: ** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)...")
(Created page with "Category:metabolite == Metabolite N-ACETYL-BETA-D-GLUCOSAMINYL-13-ETCETERA == * common-name: ** an n-acetyl-β-d-glucosaminyl-(1→3)-β-d-galactosyl-(1→4)...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7526 ==
+
== Metabolite N-ACETYL-BETA-D-GLUCOSAMINYL-13-ETCETERA ==
 
* common-name:
 
* common-name:
** 9,9'-di-cis-ζ-carotene
+
** an n-acetyl-β-d-glucosaminyl-(1→3)-β-d-galactosyl-(1→4)-n-acetyl-d-glucosaminyl-[glycoprotein]
* smiles:
 
** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c
 
* inchi-key:
 
** biwlelkafxrpde-zurblsrnsa-n
 
* molecular-weight:
 
** 540.914
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11354]]
+
* [[RXN-15276]]
* [[RXN-11356]]
 
* [[RXN-12242]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11354]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=9,9'-di-cis-ζ-carotene}}
+
{{#set: common-name=an n-acetyl-β-d-glucosaminyl-(1→3)-β-d-galactosyl-(1→4)-n-acetyl-d-glucosaminyl-[glycoprotein]}}
{{#set: inchi-key=inchikey=biwlelkafxrpde-zurblsrnsa-n}}
 
{{#set: molecular-weight=540.914}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite N-ACETYL-BETA-D-GLUCOSAMINYL-13-ETCETERA

  • common-name:
    • an n-acetyl-β-d-glucosaminyl-(1→3)-β-d-galactosyl-(1→4)-n-acetyl-d-glucosaminyl-[glycoprotein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-acetyl-β-d-glucosaminyl-(1→3)-β-d-galactosyl-(1→4)-n-acetyl-d-glucosaminyl-[glycoprotein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.