Difference between revisions of "N-ACETYL-BETA-D-GLUCOSAMINYL-13-ETCETERA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9958 == * common-name: ** ubiquinol-10 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc...")
(Created page with "Category:metabolite == Metabolite DPG == * common-name: ** 3-phospho-d-glyceroyl-phosphate * smiles: ** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-] * inchi-key: ** ljqlqc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-9958 ==
+
== Metabolite DPG ==
 
* common-name:
 
* common-name:
−
** ubiquinol-10
+
** 3-phospho-d-glyceroyl-phosphate
 
* smiles:
 
* smiles:
−
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
+
** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-]
 
* inchi-key:
 
* inchi-key:
−
** qntnkslofhefpk-uptccgcdsa-n
+
** ljqlqcaxbuheaz-uwtatzphsa-j
 
* molecular-weight:
 
* molecular-weight:
−
** 865.373
+
** 262.006
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[BISPHOSPHOGLYCERATE-MUTASE-RXN]]
 +
* [[GAPDHSYNEC-RXN]]
 +
* [[GAPDH_]]
 +
* [[GAPOXNPHOSPHN-RXN]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
* [[RXN-17274]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-9237]]
+
* [[GAPDHSYNEC-RXN]]
 +
* [[GAPDH_]]
 +
* [[GAPOXNPHOSPHN-RXN]]
 +
* [[PHOSGLYPHOS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=ubiquinol-10}}
+
{{#set: common-name=3-phospho-d-glyceroyl-phosphate}}
−
{{#set: inchi-key=inchikey=qntnkslofhefpk-uptccgcdsa-n}}
+
{{#set: inchi-key=inchikey=ljqlqcaxbuheaz-uwtatzphsa-j}}
−
{{#set: molecular-weight=865.373}}
+
{{#set: molecular-weight=262.006}}

Revision as of 15:29, 5 January 2021

Metabolite DPG

  • common-name:
    • 3-phospho-d-glyceroyl-phosphate
  • smiles:
    • c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-]
  • inchi-key:
    • ljqlqcaxbuheaz-uwtatzphsa-j
  • molecular-weight:
    • 262.006

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=N-ACETYL-BETA-D-GLUCOSAMINYL-13-ETCETERA&oldid=73814"