Difference between revisions of "N-ACETYL-BETA-GLUCOSAMINYLAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-Substituted-Glutathione == * common-name: ** a glutathione-toxin conjugate == Reaction(s) known to consume the compound == * RXN-6641...")
(Created page with "Category:metabolite == Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE == * common-name: ** n-acetyl-β-glucosaminylamine * smiles: ** cc(=o)nc1(c(n)oc(co)c(o)c(o)1) * inch...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-Substituted-Glutathione ==
+
== Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE ==
 
* common-name:
 
* common-name:
** a glutathione-toxin conjugate
+
** n-acetyl-β-glucosaminylamine
 +
* smiles:
 +
** cc(=o)nc1(c(n)oc(co)c(o)c(o)1)
 +
* inchi-key:
 +
** mcgxocxffnkasf-fmdgeedcsa-n
 +
* molecular-weight:
 +
** 220.225
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-6641]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GSHTRAN-RXN]]
+
* [[3.5.1.26-RXN]]
 +
* [[3.5.1.52-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a glutathione-toxin conjugate}}
+
{{#set: common-name=n-acetyl-β-glucosaminylamine}}
 +
{{#set: inchi-key=inchikey=mcgxocxffnkasf-fmdgeedcsa-n}}
 +
{{#set: molecular-weight=220.225}}

Latest revision as of 11:16, 18 March 2021

Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE

  • common-name:
    • n-acetyl-β-glucosaminylamine
  • smiles:
    • cc(=o)nc1(c(n)oc(co)c(o)c(o)1)
  • inchi-key:
    • mcgxocxffnkasf-fmdgeedcsa-n
  • molecular-weight:
    • 220.225

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality