Difference between revisions of "N-ACETYL-D-GLUCOSAMINE-1-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11426 == * transcription-direction: ** positive * right-end-position: ** 365972 * left-end-position: ** 335689 * centisome-position: ** 90.15028...")
 
(Created page with "Category:metabolite == Metabolite N-ACETYL-D-GLUCOSAMINE-1-P == * common-name: ** n-acetyl-α-d-glucosamine 1-phosphate * smiles: ** cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)(...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11426 ==
+
== Metabolite N-ACETYL-D-GLUCOSAMINE-1-P ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** n-acetyl-α-d-glucosamine 1-phosphate
−
* right-end-position:
+
* smiles:
−
** 365972
+
** cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)([o-])[o-])1)
−
* left-end-position:
+
* inchi-key:
−
** 335689
+
** fzljpepaypummr-fmdgeedcsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 90.15028   
+
** 299.174
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[NAG1P-URIDYLTRANS-RXN]]
−
== Reaction(s) associated ==
+
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
−
* [[INORGPYROPHOSPHAT-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[2.3.1.157-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
−
** Category: [[orthology]]
+
* [[RXN-16426]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) associated ==
+
{{#set: common-name=n-acetyl-α-d-glucosamine 1-phosphate}}
−
* [[PWY-7805]]
+
{{#set: inchi-key=inchikey=fzljpepaypummr-fmdgeedcsa-l}}
−
** '''2''' reactions found over '''8''' reactions in the full pathway
+
{{#set: molecular-weight=299.174}}
−
* [[PWY-7807]]
 
−
** '''2''' reactions found over '''7''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=365972}}
 
−
{{#set: left-end-position=335689}}
 
−
{{#set: centisome-position=90.15028    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite N-ACETYL-D-GLUCOSAMINE-1-P

  • common-name:
    • n-acetyl-α-d-glucosamine 1-phosphate
  • smiles:
    • cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)([o-])[o-])1)
  • inchi-key:
    • fzljpepaypummr-fmdgeedcsa-l
  • molecular-weight:
    • 299.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=N-ACETYL-D-GLUCOSAMINE-1-P&oldid=138393"