Difference between revisions of "N-ACETYL-D-GLUCOSAMINE-6-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LEUKOTRIENE-C4 == * common-name: ** leukotriene-c4 * smiles: ** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc(...")
(Created page with "Category:metabolite == Metabolite Crotonyl-ACPs == * common-name: ** a crotonyl-[acp] == Reaction(s) known to consume the compound == * RXN-9515 * RXN-9657 == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LEUKOTRIENE-C4 ==
+
== Metabolite Crotonyl-ACPs ==
 
* common-name:
 
* common-name:
** leukotriene-c4
+
** a crotonyl-[acp]
* smiles:
 
** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc([o-])=o)o
 
* inchi-key:
 
** gwnvdxqdilpjig-nxolixfesa-l
 
* molecular-weight:
 
** 623.76
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-336]]
+
* [[RXN-9515]]
 +
* [[RXN-9657]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
+
* [[4.2.1.58-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=leukotriene-c4}}
+
{{#set: common-name=a crotonyl-[acp]}}
{{#set: inchi-key=inchikey=gwnvdxqdilpjig-nxolixfesa-l}}
 
{{#set: molecular-weight=623.76}}
 

Revision as of 08:31, 15 March 2021

Metabolite Crotonyl-ACPs

  • common-name:
    • a crotonyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a crotonyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.