Difference between revisions of "N-ACETYL-D-GLUCOSAMINE-6-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ISOPHENOXAZINE == * common-name: ** isophenoxazine * smiles: ** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n))) * inchi-key: ** rdjxpxhqenrcn...") |
(Created page with "Category:metabolite == Metabolite N-ACETYL-D-GLUCOSAMINE-6-P == * common-name: ** n-acetyl-d-glucosamine 6-phosphate == Reaction(s) known to consume the compound == * PH...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-ACETYL-D-GLUCOSAMINE-6-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-d-glucosamine 6-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] | ||
| + | * [[RXN-16425]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-d-glucosamine 6-phosphate}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite N-ACETYL-D-GLUCOSAMINE-6-P
- common-name:
- n-acetyl-d-glucosamine 6-phosphate
