Difference between revisions of "N-ACETYL-D-GLUCOSAMINE-6-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15972 == * common-name: ** lactose == Reaction(s) known to consume the compound == * BETAGALACTOSID-RXN == Reaction(s) known to p...")
(Created page with "Category:metabolite == Metabolite ISOPHENOXAZINE == * common-name: ** isophenoxazine * smiles: ** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n))) * inchi-key: ** rdjxpxhqenrcn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15972 ==
+
== Metabolite ISOPHENOXAZINE ==
 
* common-name:
 
* common-name:
** lactose
+
** isophenoxazine
 +
* smiles:
 +
** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n)))
 +
* inchi-key:
 +
** rdjxpxhqenrcng-uhfffaoysa-n
 +
* molecular-weight:
 +
** 212.207
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[BETAGALACTOSID-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LACTOSE-SYNTHASE-RXN]]
+
* [[O-AMINOPHENOL-OXIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=lactose}}
+
{{#set: common-name=isophenoxazine}}
 +
{{#set: inchi-key=inchikey=rdjxpxhqenrcng-uhfffaoysa-n}}
 +
{{#set: molecular-weight=212.207}}

Revision as of 14:59, 5 January 2021

Metabolite ISOPHENOXAZINE

  • common-name:
    • isophenoxazine
  • smiles:
    • c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n)))
  • inchi-key:
    • rdjxpxhqenrcng-uhfffaoysa-n
  • molecular-weight:
    • 212.207

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality