Difference between revisions of "N-ACETYL-D-GLUCOSAMINE-6-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ISOPHENOXAZINE == * common-name: ** isophenoxazine * smiles: ** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n))) * inchi-key: ** rdjxpxhqenrcn...") |
(Created page with "Category:metabolite == Metabolite 16-HYDROXYPALMITATE == * common-name: ** 16-hydroxypalmitate * smiles: ** c(ccccccccccccccc([o-])=o)o * inchi-key: ** ugagpnkcdrtdhp-uhff...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 16-HYDROXYPALMITATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 16-hydroxypalmitate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(ccccccccccccccc([o-])=o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ugagpnkcdrtdhp-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 271.419 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16389]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=16-hydroxypalmitate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ugagpnkcdrtdhp-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=271.419}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite 16-HYDROXYPALMITATE
- common-name:
- 16-hydroxypalmitate
- smiles:
- c(ccccccccccccccc([o-])=o)o
- inchi-key:
- ugagpnkcdrtdhp-uhfffaoysa-m
- molecular-weight:
- 271.419
