Difference between revisions of "N-ACETYL-GLUTAMYL-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Enones == * common-name: ** an enone == Reaction(s) known to consume the compound == * RXN-12267 == Reaction(s) known to produce the...")
(Created page with "Category:metabolite == Metabolite N-ACETYL-GLUTAMYL-P == * common-name: ** n-acetylglutamyl-phosphate * smiles: ** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-] * inchi-key:...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Enones ==
+
== Metabolite N-ACETYL-GLUTAMYL-P ==
 
* common-name:
 
* common-name:
** an enone
+
** n-acetylglutamyl-phosphate
 +
* smiles:
 +
** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-]
 +
* inchi-key:
 +
** fcvihfvsxhopsw-yfkpbyrvsa-k
 +
* molecular-weight:
 +
** 266.124
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12267]]
+
* [[ACETYLGLUTKIN-RXN]]
 +
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12267]]
+
* [[ACETYLGLUTKIN-RXN]]
 +
* [[AGK]]
 +
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an enone}}
+
{{#set: common-name=n-acetylglutamyl-phosphate}}
 +
{{#set: inchi-key=inchikey=fcvihfvsxhopsw-yfkpbyrvsa-k}}
 +
{{#set: molecular-weight=266.124}}

Latest revision as of 11:15, 18 March 2021

Metabolite N-ACETYL-GLUTAMYL-P

  • common-name:
    • n-acetylglutamyl-phosphate
  • smiles:
    • cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-]
  • inchi-key:
    • fcvihfvsxhopsw-yfkpbyrvsa-k
  • molecular-weight:
    • 266.124

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality