Difference between revisions of "N-ACETYL-GLUTAMYL-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5469 RXN-5469] == * direction: ** left-to-right * common-name: ** (mannosyl)8-(n-acetylglucosam...")
 
(Created page with "Category:metabolite == Metabolite N-ACETYL-GLUTAMYL-P == * common-name: ** n-acetylglutamyl-phosphate * smiles: ** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-] * inchi-key:...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5469 RXN-5469] ==
+
== Metabolite N-ACETYL-GLUTAMYL-P ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** (mannosyl)8-(n-acetylglucosaminyl)2-diphosphodolichol:dolichyl β-d-mannosyl phosphate mannosyl transferase
+
** n-acetylglutamyl-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.4.1.261 ec-2.4.1.261]
+
** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-171]][c] '''+''' 1 [[CPD-5167]][c] '''=>''' 1 [[CPD-5168]][c] '''+''' 1 [[DOLICHOLP]][c] '''+''' 1 [[PROTON]][c]
+
** fcvihfvsxhopsw-yfkpbyrvsa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ19084]]
+
** 266.124
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ACETYLGLUTKIN-RXN]]
−
* Gene: [[SJ11915]]
+
* [[N-ACETYLGLUTPREDUCT-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[ACETYLGLUTKIN-RXN]]
−
== Pathway(s) ==
+
* [[AGK]]
−
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]], protein N-glycosylation initial phase (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]
+
* [[N-ACETYLGLUTPREDUCT-RXN]]
−
** '''16''' reactions found over '''19''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=n-acetylglutamyl-phosphate}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=fcvihfvsxhopsw-yfkpbyrvsa-k}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=266.124}}
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R06261 R06261]
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29542 29542]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=(mannosyl)8-(n-acetylglucosaminyl)2-diphosphodolichol:dolichyl β-d-mannosyl phosphate mannosyl transferase}}
 
−
{{#set: ec-number=ec-2.4.1.261}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite N-ACETYL-GLUTAMYL-P

  • common-name:
    • n-acetylglutamyl-phosphate
  • smiles:
    • cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-]
  • inchi-key:
    • fcvihfvsxhopsw-yfkpbyrvsa-k
  • molecular-weight:
    • 266.124

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=N-ACETYL-GLUTAMYL-P&oldid=138703"