Difference between revisions of "N-ACETYL-GLUTAMYL-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CU+ == * common-name: ** cu+ * smiles: ** [cu+] * inchi-key: ** vmqmzmrvkuzkql-uhfffaoysa-n * molecular-weight: ** 64.554 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-14594 == * common-name: ** linustatin * smiles: ** cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * inchi-key: ** fersmfqb...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14594 == |
* common-name: | * common-name: | ||
| − | ** | + | ** linustatin |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fersmfqbwvbkqk-cxttvelosa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 409.389 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-13602]] | |
| − | * [[RXN- | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=linustatin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fersmfqbwvbkqk-cxttvelosa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=409.389}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite CPD-14594
- common-name:
- linustatin
- smiles:
- cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
- inchi-key:
- fersmfqbwvbkqk-cxttvelosa-n
- molecular-weight:
- 409.389
