Difference between revisions of "N-ACETYL-GLUTAMYL-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14594 == * common-name: ** linustatin * smiles: ** cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * inchi-key: ** fersmfqb...") |
(Created page with "Category:metabolite == Metabolite Enones == * common-name: ** an enone == Reaction(s) known to consume the compound == * RXN-12267 == Reaction(s) known to produce the...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Enones == |
* common-name: | * common-name: | ||
| − | ** | + | ** an enone |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12267]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12267]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an enone}} |
| − | |||
| − | |||
Revision as of 15:28, 5 January 2021
Contents
Metabolite Enones
- common-name:
- an enone
