Difference between revisions of "N-ACETYL-GLUTAMYL-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9926 RXN-9926] == * direction: ** left-to-right * common-name: ** alditol oxidase ** xylitol ox...")
(Created page with "Category:metabolite == Metabolite N-ACETYL-GLUTAMYL-P == * common-name: ** n-acetylglutamyl-phosphate * smiles: ** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-] * inchi-key:...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9926 RXN-9926] ==
+
== Metabolite N-ACETYL-GLUTAMYL-P ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** alditol oxidase
+
** n-acetylglutamyl-phosphate
−
** xylitol oxidase
+
* smiles:
−
* ec-number:
+
** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-]
−
** [http://enzyme.expasy.org/EC/1.1.3.41 ec-1.1.3.41]
+
* inchi-key:
−
== Reaction formula ==
+
** fcvihfvsxhopsw-yfkpbyrvsa-k
−
* 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Sugar-alcohols]][c] '''=>''' 1 [[Aldoses]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 266.124
−
* Gene: [[SJ14476]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[ACETYLGLUTKIN-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[N-ACETYLGLUTPREDUCT-RXN]]
−
* Gene: [[SJ14480]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[ACETYLGLUTKIN-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[AGK]]
−
== Pathway(s) ==
+
* [[N-ACETYLGLUTPREDUCT-RXN]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=n-acetylglutamyl-phosphate}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=fcvihfvsxhopsw-yfkpbyrvsa-k}}
−
* RHEA:
+
{{#set: molecular-weight=266.124}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25909 25909]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=alditol oxidase|xylitol oxidase}}
 
−
{{#set: ec-number=ec-1.1.3.41}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite N-ACETYL-GLUTAMYL-P

  • common-name:
    • n-acetylglutamyl-phosphate
  • smiles:
    • cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-]
  • inchi-key:
    • fcvihfvsxhopsw-yfkpbyrvsa-k
  • molecular-weight:
    • 266.124

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=N-ACETYL-GLUTAMYL-P&oldid=138703"