Difference between revisions of "N-ACETYL-SEROTONIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5821 == * common-name: ** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline * smiles: ** c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-] * inchi-...") |
(Created page with "Category:metabolite == Metabolite N-ACETYL-SEROTONIN == * common-name: ** n-acetyl-serotonin * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2)) * inchi-key: ** mvawjsidnickh...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-ACETYL-SEROTONIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-serotonin |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mvawjsidnickhf-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 218.255 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11059]] |
| + | * [[RXN-11060]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11057]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-serotonin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mvawjsidnickhf-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=218.255}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite N-ACETYL-SEROTONIN
- common-name:
- n-acetyl-serotonin
- smiles:
- cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2))
- inchi-key:
- mvawjsidnickhf-uhfffaoysa-n
- molecular-weight:
- 218.255
