Difference between revisions of "N-ACETYL-SEROTONIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.13.1-RXN 3.1.13.1-RXN] == * direction: ** left-to-right * common-name: ** ribonuclease * ec-num...")
 
(Created page with "Category:metabolite == Metabolite N-ACETYL-SEROTONIN == * common-name: ** n-acetyl-serotonin * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2)) * inchi-key: ** mvawjsidnickh...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.13.1-RXN 3.1.13.1-RXN] ==
+
== Metabolite N-ACETYL-SEROTONIN ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** ribonuclease
+
** n-acetyl-serotonin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.13.1 ec-3.1.13.1]
+
** cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2))
−
* synonymous:
+
* inchi-key:
−
** ribonuclease ii
+
** mvawjsidnickhf-uhfffaoysa-n
−
== Reaction formula ==
+
* molecular-weight:
−
* 1 [[RNASE-II-DEGRADATION-SUBSTRATE-MRNA]][c] '''+''' n [[WATER]][c] '''=>''' n [[Nucleoside-Monophosphates]][c]
+
** 218.255
−
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ19616]]
+
* [[RXN-11059]]
−
** Category: [[annotation]]
+
* [[RXN-11060]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-11057]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=n-acetyl-serotonin}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=mvawjsidnickhf-uhfffaoysa-n}}
−
* UNIPROT:
+
{{#set: molecular-weight=218.255}}
−
** [http://www.uniprot.org/uniprot/P30850 P30850]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=ribonuclease}}
 
−
{{#set: ec-number=ec-3.1.13.1}}
 
−
{{#set: synonymous=ribonuclease ii}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite N-ACETYL-SEROTONIN

  • common-name:
    • n-acetyl-serotonin
  • smiles:
    • cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2))
  • inchi-key:
    • mvawjsidnickhf-uhfffaoysa-n
  • molecular-weight:
    • 218.255

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=N-ACETYL-SEROTONIN&oldid=138907"