Difference between revisions of "N-ALPHA-ACETYLORNITHINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DITHIOTHREITOL == * common-name: ** l-dithiothreitol * smiles: ** c(s)c(o)c(o)cs * inchi-key: ** vhjlvaabsrfdpm-imjsidkusa-n * molecular-...") |
(Created page with "Category:metabolite == Metabolite N-ALPHA-ACETYLORNITHINE == * common-name: ** n-acetyl-l-ornithine * smiles: ** cc(=o)nc(ccc[n+])c(=o)[o-] * inchi-key: ** jrlgpaxaghmnol-...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-ALPHA-ACETYLORNITHINE == |
* common-name: | * common-name: | ||
| − | ** l- | + | ** n-acetyl-l-ornithine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)nc(ccc[n+])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jrlgpaxaghmnol-lurjtmiesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 174.199 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ACETYLORNDEACET-RXN]] |
| + | * [[ACETYLORNTRANSAM-RXN]] | ||
| + | * [[AODAA]] | ||
| + | * [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ACETYLORNDEACET-RXN]] |
| + | * [[ACETYLORNTRANSAM-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=l- | + | {{#set: common-name=n-acetyl-l-ornithine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jrlgpaxaghmnol-lurjtmiesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=174.199}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite N-ALPHA-ACETYLORNITHINE
- common-name:
- n-acetyl-l-ornithine
- smiles:
- cc(=o)nc(ccc[n+])c(=o)[o-]
- inchi-key:
- jrlgpaxaghmnol-lurjtmiesa-n
- molecular-weight:
- 174.199
