Difference between revisions of "N-ALPHA-ACETYLORNITHINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08838 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * LPLPS1AGPE180h ** Cate...") |
(Created page with "Category:metabolite == Metabolite N-ALPHA-ACETYLORNITHINE == * common-name: ** n-acetyl-l-ornithine * smiles: ** cc(=o)nc(ccc[n+])c(=o)[o-] * inchi-key: ** jrlgpaxaghmnol-...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite N-ALPHA-ACETYLORNITHINE == |
| − | = | + | * common-name: |
| − | * | + | ** n-acetyl-l-ornithine |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** cc(=o)nc(ccc[n+])c(=o)[o-] |
| − | ** | + | * inchi-key: |
| − | ** | + | ** jrlgpaxaghmnol-lurjtmiesa-n |
| − | {{#set: | + | * molecular-weight: |
| − | {{#set: | + | ** 174.199 |
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[ACETYLORNDEACET-RXN]] | ||
| + | * [[ACETYLORNTRANSAM-RXN]] | ||
| + | * [[AODAA]] | ||
| + | * [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[ACETYLORNDEACET-RXN]] | ||
| + | * [[ACETYLORNTRANSAM-RXN]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=n-acetyl-l-ornithine}} | ||
| + | {{#set: inchi-key=inchikey=jrlgpaxaghmnol-lurjtmiesa-n}} | ||
| + | {{#set: molecular-weight=174.199}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite N-ALPHA-ACETYLORNITHINE
- common-name:
- n-acetyl-l-ornithine
- smiles:
- cc(=o)nc(ccc[n+])c(=o)[o-]
- inchi-key:
- jrlgpaxaghmnol-lurjtmiesa-n
- molecular-weight:
- 174.199
