Difference between revisions of "N-ALPHA-ACETYLORNITHINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DNA-containing-a-Apyrimidinic-Sites == * common-name: ** an apyrimidinic site in dna == Reaction(s) known to consume the compound == == R...")
(Created page with "Category:metabolite == Metabolite N-ALPHA-ACETYLORNITHINE == * common-name: ** n-acetyl-l-ornithine * smiles: ** cc(=o)nc(ccc[n+])c(=o)[o-] * inchi-key: ** jrlgpaxaghmnol-...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DNA-containing-a-Apyrimidinic-Sites ==
+
== Metabolite N-ALPHA-ACETYLORNITHINE ==
 
* common-name:
 
* common-name:
** an apyrimidinic site in dna
+
** n-acetyl-l-ornithine
 +
* smiles:
 +
** cc(=o)nc(ccc[n+])c(=o)[o-]
 +
* inchi-key:
 +
** jrlgpaxaghmnol-lurjtmiesa-n
 +
* molecular-weight:
 +
** 174.199
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACETYLORNDEACET-RXN]]
 +
* [[ACETYLORNTRANSAM-RXN]]
 +
* [[AODAA]]
 +
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11049]]
+
* [[ACETYLORNDEACET-RXN]]
* [[RXN0-2584]]
+
* [[ACETYLORNTRANSAM-RXN]]
* [[RXN0-2601]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an apyrimidinic site in dna}}
+
{{#set: common-name=n-acetyl-l-ornithine}}
 +
{{#set: inchi-key=inchikey=jrlgpaxaghmnol-lurjtmiesa-n}}
 +
{{#set: molecular-weight=174.199}}

Latest revision as of 11:14, 18 March 2021

Metabolite N-ALPHA-ACETYLORNITHINE

  • common-name:
    • n-acetyl-l-ornithine
  • smiles:
    • cc(=o)nc(ccc[n+])c(=o)[o-]
  • inchi-key:
    • jrlgpaxaghmnol-lurjtmiesa-n
  • molecular-weight:
    • 174.199

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality