Difference between revisions of "N-ALPHA-ACETYLORNITHINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12016 == * common-name: ** n-acetyl-serotonin glucuronide * smiles: ** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23)...")
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N1-Methylguanine-9 == * common-name: ** an n1-methylguanine9 in trna == Reaction(s) known to consume the compound == == R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12016 ==
+
== Metabolite tRNA-Containing-N1-Methylguanine-9 ==
 
* common-name:
 
* common-name:
** n-acetyl-serotonin glucuronide
+
** an n1-methylguanine9 in trna
* smiles:
 
** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23))
 
* inchi-key:
 
** drkqfnyksnwotc-rngzqalnsa-m
 
* molecular-weight:
 
** 393.372
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11060]]
+
* [[RXN-12459]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-serotonin glucuronide}}
+
{{#set: common-name=an n1-methylguanine9 in trna}}
{{#set: inchi-key=inchikey=drkqfnyksnwotc-rngzqalnsa-m}}
 
{{#set: molecular-weight=393.372}}
 

Revision as of 13:10, 14 January 2021

Metabolite tRNA-Containing-N1-Methylguanine-9

  • common-name:
    • an n1-methylguanine9 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality