Difference between revisions of "N-ALPHA-ACETYLORNITHINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02255 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN **...") |
(Created page with "Category:metabolite == Metabolite SHIKIMATE == * common-name: ** shikimate * smiles: ** c1(=c(cc(c(o)c(o)1)o)c(=o)[o-]) * inchi-key: ** jxohggnkmltubp-hsuxutppsa-m * molec...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite SHIKIMATE == |
− | = | + | * common-name: |
− | * | + | ** shikimate |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c1(=c(cc(c(o)c(o)1)o)c(=o)[o-]) |
− | * | + | * inchi-key: |
− | * | + | ** jxohggnkmltubp-hsuxutppsa-m |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 173.145 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-7968]] | ||
+ | * [[SHIKIMATE-KINASE-RXN]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[SHIKIMATE-5-DEHYDROGENASE-RXN]] | ||
+ | * [[SHIKIMATE-KINASE-RXN]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=shikimate}} | ||
+ | {{#set: inchi-key=inchikey=jxohggnkmltubp-hsuxutppsa-m}} | ||
+ | {{#set: molecular-weight=173.145}} |
Revision as of 20:33, 18 December 2020
Contents
Metabolite SHIKIMATE
- common-name:
- shikimate
- smiles:
- c1(=c(cc(c(o)c(o)1)o)c(=o)[o-])
- inchi-key:
- jxohggnkmltubp-hsuxutppsa-m
- molecular-weight:
- 173.145