Difference between revisions of "N-Ac-L-methionyl-L-asparaginyl-Protein"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HOMO-I-CIT == * common-name: ** (1r,2s)-homoisocitrate * smiles: ** c(cc(=o)[o-])c(c(=o)[o-])c(o)c(=o)[o-] * inchi-key: ** oejzzcgrgvfwhk...") |
(Created page with "Category:metabolite == Metabolite N-Ac-L-methionyl-L-asparaginyl-Protein == * common-name: ** an n-terminal-nα-acetyl-l-methionyl-l-asparaginyl-[protein] == Reaction...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-Ac-L-methionyl-L-asparaginyl-Protein == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-terminal-nα-acetyl-l-methionyl-l-asparaginyl-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-17892]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-terminal-nα-acetyl-l-methionyl-l-asparaginyl-[protein]}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite N-Ac-L-methionyl-L-asparaginyl-Protein
- common-name:
- an n-terminal-nα-acetyl-l-methionyl-l-asparaginyl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-terminal-nα-acetyl-l-methionyl-l-asparaginyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
