Difference between revisions of "N-Acetyl-beta-D-Hexosaminides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-590 == * common-name: ** (2r,3s,4s)-leucocyanidin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o) * inchi-key: ** s...") |
(Created page with "Category:metabolite == Metabolite N-Acetyl-beta-D-Hexosaminides == * common-name: ** an n-acetyl-β-d-hexosaminide == Reaction(s) known to consume the compound == * ...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-Acetyl-beta-D-Hexosaminides == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-acetyl-β-d-hexosaminide |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.2.1.52-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-acetyl-β-d-hexosaminide}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite N-Acetyl-beta-D-Hexosaminides
- common-name:
- an n-acetyl-β-d-hexosaminide
