|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=XMPXAN-RXN XMPXAN-RXN] == | + | == Metabolite GUANOSINE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** xmp phosphohydrolase | + | ** guanosine |
| − | ** 5'-nucleotidase | + | * smiles: |
| − | * ec-number:
| + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
| − | ** [http://enzyme.expasy.org/EC/3.1.3.5 ec-3.1.3.5] | + | * inchi-key: |
| − | == Reaction formula ==
| + | ** nyhbqmygnkiuif-uuokfmhzsa-n |
| − | * 1 [[WATER]][c] '''+''' 1 [[XANTHOSINE-5-PHOSPHATE]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[XANTHOSINE]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction == | + | ** 283.243 |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ18402]] | + | * [[RXN0-366]] |
| − | ** Category: [[annotation]]
| + | * [[RXN0-5199]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]]
| + | * [[RXN-7609]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN0-5199]] |
| − | * Gene: [[SJ18895]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]] | + | {{#set: common-name=guanosine}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: inchi-key=inchikey=nyhbqmygnkiuif-uuokfmhzsa-n}} |
| − | * Gene: [[SJ09030]]
| + | {{#set: molecular-weight=283.243}} |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ16098]] | |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ15366]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-6596]], adenosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6596 PWY-6596] | |
| − | ** '''7''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-5695]], inosine 5'-phosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5695 PWY-5695] | |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28531 28531]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R02719 R02719]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=5'-nucleotidase|xmp phosphohydrolase}} | |
| − | {{#set: ec-number=ec-3.1.3.5}} | |
| − | {{#set: nb gene associated=5}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
