Difference between revisions of "N-Acylethanolamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Reduced-CycA1-cytochromes == * common-name: ** a reduced cyca1 cytochrome == Reaction(s) known to consume the compound == * RXN-15829...") |
(Created page with "Category:metabolite == Metabolite SCOPOLETIN == * common-name: ** scopoletin * smiles: ** coc2(c=c1(c(oc(=o)c=c1)=cc=2o)) * inchi-key: ** rodxrvnmmdrfik-uhfffaoysa-n * mol...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SCOPOLETIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** scopoletin |
| + | * smiles: | ||
| + | ** coc2(c=c1(c(oc(=o)c=c1)=cc=2o)) | ||
| + | * inchi-key: | ||
| + | ** rodxrvnmmdrfik-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 192.171 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14179]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=scopoletin}} |
| + | {{#set: inchi-key=inchikey=rodxrvnmmdrfik-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=192.171}} | ||
Revision as of 11:12, 15 January 2021
Contents
Metabolite SCOPOLETIN
- common-name:
- scopoletin
- smiles:
- coc2(c=c1(c(oc(=o)c=c1)=cc=2o))
- inchi-key:
- rodxrvnmmdrfik-uhfffaoysa-n
- molecular-weight:
- 192.171
