Difference between revisions of "N-Acylethanolamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6 == * common-name: ** (5s)-hpete * smiles: ** cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o * inchi-key: ** jnuun...") |
(Created page with "Category:metabolite == Metabolite N-Acylethanolamines == * common-name: ** an n-acylethanolamine == Reaction(s) known to consume the compound == == Reaction(s) known to pr...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-Acylethanolamines == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-acylethanolamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12116]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-acylethanolamine}} |
| − | |||
| − | |||
Latest revision as of 11:10, 18 March 2021
Contents
Metabolite N-Acylethanolamines
- common-name:
- an n-acylethanolamine
