Difference between revisions of "N-Acylethanolamines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLN == * common-name: ** l-glutamine * smiles: ** c(=o)(n)ccc([n+])c([o-])=o * inchi-key: ** zdxpyrjpndtmrx-vkhmyheasa-n * molecular-weig...")
(Created page with "Category:metabolite == Metabolite N-Acylethanolamines == * common-name: ** an n-acylethanolamine == Reaction(s) known to consume the compound == == Reaction(s) known to pr...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLN ==
+
== Metabolite N-Acylethanolamines ==
 
* common-name:
 
* common-name:
** l-glutamine
+
** an n-acylethanolamine
* smiles:
 
** c(=o)(n)ccc([n+])c([o-])=o
 
* inchi-key:
 
** zdxpyrjpndtmrx-vkhmyheasa-n
 
* molecular-weight:
 
** 146.146
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[2.6.1.64-RXN]]
 
* [[6.3.5.6-RXN]]
 
* [[6.3.5.7-RXN]]
 
* [[ANTHRANSYN-RXN]]
 
* [[ASNSYNB-RXN]]
 
* [[CARBPSYN-RXN]]
 
* [[CTPSYN-RXN]]
 
* [[FGAMSYN-RXN]]
 
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
 
* [[GLUTAMATESYN-RXN]]
 
* [[GLUTAMIDOTRANS-RXN]]
 
* [[GLUTAMIN-RXN]]
 
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
 
* [[GMP-SYN-GLUT-RXN]]
 
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 
* [[NAD-SYNTH-GLN-RXN]]
 
* [[PABASYN-RXN]]
 
* [[PRPPAMIDOTRANS-RXN]]
 
* [[RXN-11322]]
 
* [[biomass_rxn]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.64-RXN]]
+
* [[RXN-12116]]
* [[ANTHRANSYN-RXN]]
 
* [[GLUTAMINESYN-RXN]]
 
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 
* [[PABASYN-RXN]]
 
* [[PRPPAMIDOTRANS-RXN]]
 
* [[RXN0-6976]]
 
* [[RXN0-6983]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-glutamine}}
+
{{#set: common-name=an n-acylethanolamine}}
{{#set: inchi-key=inchikey=zdxpyrjpndtmrx-vkhmyheasa-n}}
 
{{#set: molecular-weight=146.146}}
 

Latest revision as of 11:10, 18 March 2021

Metabolite N-Acylethanolamines

  • common-name:
    • an n-acylethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality