Difference between revisions of "N-Acylethanolamines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-alpha-Linolenoyl-2-acyl-glycerolipids == * common-name: ** a 1-α-linolenoyl 2-acyl-[glycerolipid] == Reaction(s) known to consume...")
(Created page with "Category:metabolite == Metabolite GLN == * common-name: ** l-glutamine * smiles: ** c(=o)(n)ccc([n+])c([o-])=o * inchi-key: ** zdxpyrjpndtmrx-vkhmyheasa-n * molecular-weig...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-alpha-Linolenoyl-2-acyl-glycerolipids ==
+
== Metabolite GLN ==
 
* common-name:
 
* common-name:
** a 1-α-linolenoyl 2-acyl-[glycerolipid]
+
** l-glutamine
 +
* smiles:
 +
** c(=o)(n)ccc([n+])c([o-])=o
 +
* inchi-key:
 +
** zdxpyrjpndtmrx-vkhmyheasa-n
 +
* molecular-weight:
 +
** 146.146
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16994]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2.6.1.64-RXN]]
 +
* [[6.3.5.6-RXN]]
 +
* [[6.3.5.7-RXN]]
 +
* [[ANTHRANSYN-RXN]]
 +
* [[ASNSYNB-RXN]]
 +
* [[CARBPSYN-RXN]]
 +
* [[CTPSYN-RXN]]
 +
* [[FGAMSYN-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
 +
* [[GLUTAMATESYN-RXN]]
 +
* [[GLUTAMIDOTRANS-RXN]]
 +
* [[GLUTAMIN-RXN]]
 +
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
 +
* [[GMP-SYN-GLUT-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[NAD-SYNTH-GLN-RXN]]
 +
* [[PABASYN-RXN]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[RXN-11322]]
 +
* [[biomass_rxn]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16994]]
+
* [[2.6.1.64-RXN]]
 +
* [[ANTHRANSYN-RXN]]
 +
* [[GLUTAMINESYN-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[PABASYN-RXN]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[RXN0-6976]]
 +
* [[RXN0-6983]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 1-&alpha;-linolenoyl 2-acyl-[glycerolipid]}}
+
{{#set: common-name=l-glutamine}}
 +
{{#set: inchi-key=inchikey=zdxpyrjpndtmrx-vkhmyheasa-n}}
 +
{{#set: molecular-weight=146.146}}

Revision as of 13:07, 14 January 2021