Difference between revisions of "N-Acylethanolamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLN == * common-name: ** l-glutamine * smiles: ** c(=o)(n)ccc([n+])c([o-])=o * inchi-key: ** zdxpyrjpndtmrx-vkhmyheasa-n * molecular-weig...") |
(Created page with "Category:metabolite == Metabolite Reduced-CycA1-cytochromes == * common-name: ** a reduced cyca1 cytochrome == Reaction(s) known to consume the compound == * RXN-15829...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Reduced-CycA1-cytochromes == |
* common-name: | * common-name: | ||
| − | ** | + | ** a reduced cyca1 cytochrome |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-15829]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a reduced cyca1 cytochrome}} |
| − | |||
| − | |||
Revision as of 18:52, 14 January 2021
Contents
Metabolite Reduced-CycA1-cytochromes
- common-name:
- a reduced cyca1 cytochrome
