|
|
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ21705 == | + | == Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** (5s)-hpete |
| − | * right-end-position: | + | * smiles: |
| − | ** 135568 | + | ** cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o |
| − | * left-end-position: | + | * inchi-key: |
| − | ** 119655 | + | ** jnuunuqhxiofda-jgklhwiesa-m |
| − | * centisome-position: | + | * molecular-weight: |
| − | ** 10.57764 | + | ** 335.462 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]] | + | * [[RXN-8647]] |
| − | == Reaction(s) associated == | + | == Reaction(s) known to produce the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * [[ARACHIDONATE-5-LIPOXYGENASE-RXN]] |
| − | * [[CDPKIN-RXN]] | + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=(5s)-hpete}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: inchi-key=inchikey=jnuunuqhxiofda-jgklhwiesa-m}} |
| − | ** Category: [[orthology]]
| + | {{#set: molecular-weight=335.462}} |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DADPKIN-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DCDPKIN-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DGDPKIN-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DTDPKIN-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[DUDPKIN-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[GDPKIN-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[NUCLEOSIDE-DIP-KIN-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-14120]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-14228]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[UDPKIN-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-7205]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7220]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7227]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7224]]
| |
| − | ** '''3''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-6545]]
| |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-7197]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY0-166]]
| |
| − | ** '''14''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-7210]]
| |
| − | ** '''8''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7198]]
| |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7184]]
| |
| − | ** '''9''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-7222]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7226]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7187]]
| |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PPGPPMET-PWY]]
| |
| − | ** '''5''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-7221]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7176]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=135568}} | |
| − | {{#set: left-end-position=119655}}
| |
| − | {{#set: centisome-position=10.57764 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=11}}
| |
| − | {{#set: nb pathway associated=16}}
| |
