Difference between revisions of "N-Acylethanolamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SCOPOLETIN == * common-name: ** scopoletin * smiles: ** coc2(c=c1(c(oc(=o)c=c1)=cc=2o)) * inchi-key: ** rodxrvnmmdrfik-uhfffaoysa-n * mol...") |
(Created page with "Category:gene == Gene SJ21111 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * UDPNACETYLMURAMATEDEHYDR...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ21111 == |
− | * | + | == Organism(s) associated with this gene == |
− | ** | + | * [[S.japonica_carotenoid_curated]] |
− | * | + | == Reaction(s) associated == |
− | + | * [[UDPNACETYLMURAMATEDEHYDROG-RXN]] | |
− | * | + | ** Category: [[orthology]] |
− | ** | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a |
− | * | + | == Pathway(s) associated == |
− | ** | + | * [[PWY-6387]] |
− | + | ** '''2''' reactions found over '''8''' reactions in the full pathway | |
− | + | * [[PWY0-1261]] | |
− | * [[ | + | ** '''3''' reactions found over '''12''' reactions in the full pathway |
− | + | * [[PWY-7953]] | |
− | {{#set: | + | ** '''2''' reactions found over '''8''' reactions in the full pathway |
− | {{#set: | + | * [[PWY-6386]] |
− | {{#set: | + | ** '''2''' reactions found over '''8''' reactions in the full pathway |
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=1}} | ||
+ | {{#set: nb pathway associated=4}} |
Revision as of 08:23, 15 March 2021
Contents
Gene SJ21111
Organism(s) associated with this gene
Reaction(s) associated
- UDPNACETYLMURAMATEDEHYDROG-RXN
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: orthology
Pathway(s) associated
- PWY-6387
- 2 reactions found over 8 reactions in the full pathway
- PWY0-1261
- 3 reactions found over 12 reactions in the full pathway
- PWY-7953
- 2 reactions found over 8 reactions in the full pathway
- PWY-6386
- 2 reactions found over 8 reactions in the full pathway