Difference between revisions of "N-Acylphosphatidylethanolamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HIS == * common-name: ** l-histidine * smiles: ** c1(nc=nc=1cc(c(=o)[o-])[n+]) * inchi-key: ** hndvdqjcigzpno-yfkpbyrvsa-n * molecular-we...") |
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY == * common-name: ** prostaglandin f2α * smiles: ** cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY == |
* common-name: | * common-name: | ||
| − | ** | + | ** prostaglandin f2α |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pxgpltodnuvgfl-ynnpmvkqsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 353.478 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.1.1.188-RXN]] |
| − | * [[ | + | * [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.1.1.188-RXN]] |
| − | * [[ | + | * [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=prostaglandin f2α}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pxgpltodnuvgfl-ynnpmvkqsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=353.478}} |
Revision as of 08:25, 15 March 2021
Contents
Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY
- common-name:
- prostaglandin f2α
- smiles:
- cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)
- inchi-key:
- pxgpltodnuvgfl-ynnpmvkqsa-m
- molecular-weight:
- 353.478
