Difference between revisions of "N-Acylphosphatidylethanolamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8999 == * common-name: ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate * smiles: ** csccc(=o)c(=o)cop([o-])(=o)[o-] * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite N-Acylphosphatidylethanolamines == * common-name: ** an n-acylphosphatidylethanolamine == Reaction(s) known to consume the compound == *...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-Acylphosphatidylethanolamines == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-acylphosphatidylethanolamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12116]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-acylphosphatidylethanolamine}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite N-Acylphosphatidylethanolamines
- common-name:
- an n-acylphosphatidylethanolamine
