Difference between revisions of "N-Acylphosphatidylethanolamines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY == * common-name: ** n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine * smiles: ** cc(c)c(nc...")
(Created page with "Category:metabolite == Metabolite ALLYSINE == * common-name: ** (s)-2-amino-6-oxohexanoate * smiles: ** [ch](=o)cccc([n+])c(=o)[o-] * inchi-key: ** gfxytqpnnxgict-yfkpbyrv...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY ==
+
== Metabolite ALLYSINE ==
 
* common-name:
 
* common-name:
** n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine
+
** (s)-2-amino-6-oxohexanoate
 
* smiles:
 
* smiles:
** cc(c)c(nc(=o)c(nc(=o)cccc([n+])c(=o)[o-])cs)c(=o)[o-]
+
** [ch](=o)cccc([n+])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** byeijzfkoaxbbv-qxewzrgksa-m
+
** gfxytqpnnxgict-yfkpbyrvsa-n
 
* molecular-weight:
 
* molecular-weight:
** 362.42
+
** 145.158
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.21.3.1-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.5.1.9-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine}}
+
{{#set: common-name=(s)-2-amino-6-oxohexanoate}}
{{#set: inchi-key=inchikey=byeijzfkoaxbbv-qxewzrgksa-m}}
+
{{#set: inchi-key=inchikey=gfxytqpnnxgict-yfkpbyrvsa-n}}
{{#set: molecular-weight=362.42}}
+
{{#set: molecular-weight=145.158}}

Revision as of 18:53, 14 January 2021

Metabolite ALLYSINE

  • common-name:
    • (s)-2-amino-6-oxohexanoate
  • smiles:
    • [ch](=o)cccc([n+])c(=o)[o-]
  • inchi-key:
    • gfxytqpnnxgict-yfkpbyrvsa-n
  • molecular-weight:
    • 145.158

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality