Difference between revisions of "N-Acylsphingosine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GERANYL-PP == * common-name: ** geranyl diphosphate * smiles: ** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c * inchi-key: ** gvvpgtzrzfn...")
(Created page with "Category:metabolite == Metabolite CPD-10269 == * common-name: ** palmitoleoyl-coa * smiles: ** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GERANYL-PP ==
+
== Metabolite CPD-10269 ==
 
* common-name:
 
* common-name:
** geranyl diphosphate
+
** palmitoleoyl-coa
 
* smiles:
 
* smiles:
** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
+
** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** gvvpgtzrzfnkds-jxmrogbwsa-k
+
** qbyoccwnzaoztl-mdmkaecgsa-j
 
* molecular-weight:
 
* molecular-weight:
** 311.188
+
** 999.899
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FPPS]]
+
* [[RXN-10662]]
* [[FPPSYN-RXN]]
+
* [[RXN-17008]]
* [[GPPSYN-RXN]]
+
* [[RXN-17009]]
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
+
* [[RXN-17019]]
 +
* [[RXN-17788]]
 +
* [[RXN-9616]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GPPS]]
+
* [[RXN-10664]]
* [[GPPSYN-RXN]]
+
* [[RXN-17787]]
 +
* [[RXN0-7248]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=geranyl diphosphate}}
+
{{#set: common-name=palmitoleoyl-coa}}
{{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}}
+
{{#set: inchi-key=inchikey=qbyoccwnzaoztl-mdmkaecgsa-j}}
{{#set: molecular-weight=311.188}}
+
{{#set: molecular-weight=999.899}}

Revision as of 11:13, 15 January 2021

Metabolite CPD-10269

  • common-name:
    • palmitoleoyl-coa
  • smiles:
    • ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • qbyoccwnzaoztl-mdmkaecgsa-j
  • molecular-weight:
    • 999.899

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality