Difference between revisions of "N-Acylsphingosine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Rubisco-lysine == * common-name: ** a [ribulose-1,5-bisphosphate-carboxylase]-lysine == Reaction(s) known to consume the compound == * ...")
(Created page with "Category:metabolite == Metabolite SIROHYDROCHLORIN == * common-name: ** sirohydrochlorin * smiles: ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Rubisco-lysine ==
+
== Metabolite SIROHYDROCHLORIN ==
 
* common-name:
 
* common-name:
** a [ribulose-1,5-bisphosphate-carboxylase]-lysine
+
** sirohydrochlorin
 +
* smiles:
 +
** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
 +
* inchi-key:
 +
** kwizrxmmfrbuml-ahgfgahvsa-f
 +
* molecular-weight:
 +
** 854.779
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.127-RXN]]
+
* [[4.99.1.3-RXN]]
 +
* [[SIROHEME-FERROCHELAT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DIMETHUROPORDEHYDROG-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [ribulose-1,5-bisphosphate-carboxylase]-lysine}}
+
{{#set: common-name=sirohydrochlorin}}
 +
{{#set: inchi-key=inchikey=kwizrxmmfrbuml-ahgfgahvsa-f}}
 +
{{#set: molecular-weight=854.779}}

Revision as of 14:54, 5 January 2021

Metabolite SIROHYDROCHLORIN

  • common-name:
    • sirohydrochlorin
  • smiles:
    • cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
  • inchi-key:
    • kwizrxmmfrbuml-ahgfgahvsa-f
  • molecular-weight:
    • 854.779

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality