Difference between revisions of "N-ETHYLMALEIMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-381 == * common-name: ** (s)-2-hydroxyglutarate * smiles: ** c(=o)([o-])c(o)ccc(=o)[o-] * inchi-key: ** hwxbtnavrsuojr-vkhmyheasa-l *...") |
(Created page with "Category:metabolite == Metabolite N-ETHYLMALEIMIDE == * common-name: ** n-ethylmaleimide * smiles: ** ccn1(c(=o)c=cc(=o)1) * inchi-key: ** hdfgopsgaurceo-uhfffaoysa-n * mo...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-ETHYLMALEIMIDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-ethylmaleimide |
* smiles: | * smiles: | ||
| − | ** c(=o | + | ** ccn1(c(=o)c=cc(=o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hdfgopsgaurceo-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 125.127 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-5101]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-ethylmaleimide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hdfgopsgaurceo-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=125.127}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite N-ETHYLMALEIMIDE
- common-name:
- n-ethylmaleimide
- smiles:
- ccn1(c(=o)c=cc(=o)1)
- inchi-key:
- hdfgopsgaurceo-uhfffaoysa-n
- molecular-weight:
- 125.127
