Difference between revisions of "N-ETHYLMALEIMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17049 == * common-name: ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))n...")
(Created page with "Category:metabolite == Metabolite N-ETHYLMALEIMIDE == * common-name: ** n-ethylmaleimide * smiles: ** ccn1(c(=o)c=cc(=o)1) * inchi-key: ** hdfgopsgaurceo-uhfffaoysa-n * mo...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17049 ==
+
== Metabolite N-ETHYLMALEIMIDE ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
+
** n-ethylmaleimide
 
* smiles:
 
* smiles:
** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))nc(=o)2)
+
** ccn1(c(=o)c=cc(=o)1)
 
* inchi-key:
 
* inchi-key:
** vzgsjjjqzptkgr-vxgbxaggsa-n
+
** hdfgopsgaurceo-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 298.374
+
** 125.127
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15684]]
+
* [[RXN0-5101]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=n-ethylmaleimide}}
{{#set: inchi-key=inchikey=vzgsjjjqzptkgr-vxgbxaggsa-n}}
+
{{#set: inchi-key=inchikey=hdfgopsgaurceo-uhfffaoysa-n}}
{{#set: molecular-weight=298.374}}
+
{{#set: molecular-weight=125.127}}

Latest revision as of 11:13, 18 March 2021

Metabolite N-ETHYLMALEIMIDE

  • common-name:
    • n-ethylmaleimide
  • smiles:
    • ccn1(c(=o)c=cc(=o)1)
  • inchi-key:
    • hdfgopsgaurceo-uhfffaoysa-n
  • molecular-weight:
    • 125.127

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality